C26H30F3N3O2 — CID 55407549
azepan-1-yl-[1-[2-[3-(trifluoromethyl)anilino]benzoyl]piperidin-4-yl]methanone (PubChem CID 55407549) has the molecular formula C26H30F3N3O2 and a molecular weight of 473.54 g/mol. Its IUPAC name is azepan-1-yl-[1-[2-[3-(trifluoromethyl)anilino]benzoyl]piperidin-4-yl]methanone.
| Compound Name | azepan-1-yl-[1-[2-[3-(trifluoromethyl)anilino]benzoyl]piperidin-4-yl]methanone |
|---|---|
| PubChem CID | 55407549 |
| Molecular Formula | C26H30F3N3O2 |
| Molecular Weight | 473.54 g/mol |
| Exact Mass | 473.23 |
| IUPAC Name | azepan-1-yl-[1-[2-[3-(trifluoromethyl)anilino]benzoyl]piperidin-4-yl]methanone |
| SMILES | O=C(c1ccccc1Nc1cccc(C(F)(F)F)c1)N1CCC(C(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C26H30F3N3O2/c27-26(28,29)20-8-7-9-21(18-20)30-23-11-4-3-10-22(23)25(34)32-16-12-19(13-17-32)24(33)31-14-5-1-2-6-15-31/h3-4,7-11,18-19,30H,1-2,5-6,12-17H2 |
| InChIKey | YEJUYUQQXVNLKK-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |