C25H29F3N4O2 — CID 35615387
1-piperidin-1-yl-2-[4-[2-[3-(trifluoromethyl)anilino]benzoyl]piperazin-1-yl]ethanone (PubChem CID 35615387) has the molecular formula C25H29F3N4O2 and a molecular weight of 474.53 g/mol. Its IUPAC name is 1-piperidin-1-yl-2-[4-[2-[3-(trifluoromethyl)anilino]benzoyl]piperazin-1-yl]ethanone.
| Compound Name | 1-piperidin-1-yl-2-[4-[2-[3-(trifluoromethyl)anilino]benzoyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 35615387 |
| Molecular Formula | C25H29F3N4O2 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | 1-piperidin-1-yl-2-[4-[2-[3-(trifluoromethyl)anilino]benzoyl]piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCN(C(=O)c2ccccc2Nc2cccc(C(F)(F)F)c2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C25H29F3N4O2/c26-25(27,28)19-7-6-8-20(17-19)29-22-10-3-2-9-21(22)24(34)32-15-13-30(14-16-32)18-23(33)31-11-4-1-5-12-31/h2-3,6-10,17,29H,1,4-5,11-16,18H2 |
| InChIKey | IMIXEUBKGBVYCQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |