C18H24IN3O2 — CID 30543126
2-[4-(2-iodobenzoyl)piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 30543126) has the molecular formula C18H24IN3O2 and a molecular weight of 441.31 g/mol. Its IUPAC name is 2-[4-(2-iodobenzoyl)piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(2-iodobenzoyl)piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 30543126 |
| Molecular Formula | C18H24IN3O2 |
| Molecular Weight | 441.31 g/mol |
| Exact Mass | 441.09 |
| IUPAC Name | 2-[4-(2-iodobenzoyl)piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(=O)c2ccccc2I)CC1)N1CCCCC1 |
| InChI | InChI=1S/C18H24IN3O2/c19-16-7-3-2-6-15(16)18(24)22-12-10-20(11-13-22)14-17(23)21-8-4-1-5-9-21/h2-3,6-7H,1,4-5,8-14H2 |
| InChIKey | ZOEKQSCQEADDBT-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.31 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|