C25H30FN3O3 — CID 30543175
2-[4-[2-[(4-fluorophenyl)methoxy]benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 30543175) has the molecular formula C25H30FN3O3 and a molecular weight of 439.53 g/mol. Its IUPAC name is 2-[4-[2-[(4-fluorophenyl)methoxy]benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-[2-[(4-fluorophenyl)methoxy]benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 30543175 |
| Molecular Formula | C25H30FN3O3 |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | 2-[4-[2-[(4-fluorophenyl)methoxy]benzoyl]piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | O=C(CN1CCN(C(=O)c2ccccc2OCc2ccc(F)cc2)CC1)N1CCCCC1 |
| InChI | InChI=1S/C25H30FN3O3/c26-21-10-8-20(9-11-21)19-32-23-7-3-2-6-22(23)25(31)29-16-14-27(15-17-29)18-24(30)28-12-4-1-5-13-28/h2-3,6-11H,1,4-5,12-19H2 |
| InChIKey | IQDDEVKTVWESOW-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |