C23H23FN2O2S — CID 17477211
[2-[(4-fluorophenyl)methoxy]phenyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 17477211) has the molecular formula C23H23FN2O2S and a molecular weight of 410.51 g/mol. Its IUPAC name is [2-[(4-fluorophenyl)methoxy]phenyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | [2-[(4-fluorophenyl)methoxy]phenyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 17477211 |
| Molecular Formula | C23H23FN2O2S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | [2-[(4-fluorophenyl)methoxy]phenyl]-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccccc1OCc1ccc(F)cc1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C23H23FN2O2S/c24-19-9-7-18(8-10-19)17-28-22-6-2-1-5-21(22)23(27)26-13-11-25(12-14-26)16-20-4-3-15-29-20/h1-10,15H,11-14,16-17H2 |
| InChIKey | NSCIOPHSTMTIOM-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |