C16H16BrFN2OS — CID 31328462
(2-bromo-4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 31328462) has the molecular formula C16H16BrFN2OS and a molecular weight of 383.29 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (2-bromo-4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 31328462 |
| Molecular Formula | C16H16BrFN2OS |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (2-bromo-4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1Br)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H16BrFN2OS/c17-15-10-12(18)3-4-14(15)16(21)20-7-5-19(6-8-20)11-13-2-1-9-22-13/h1-4,9-10H,5-8,11H2 |
| InChIKey | IGJNYJWAQXRNEP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |