C16H17FN2OS — CID 60655593
(4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 60655593) has the molecular formula C16H17FN2OS and a molecular weight of 304.39 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60655593 |
| Molecular Formula | C16H17FN2OS |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | (4-fluorophenyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H17FN2OS/c17-14-5-3-13(4-6-14)16(20)19-9-7-18(8-10-19)12-15-2-1-11-21-15/h1-6,11H,7-10,12H2 |
| InChIKey | ZARBIFNYQTZUMG-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |