C15H17N3O2S — CID 63859389
(5-hydroxy-3-pyridinyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 63859389) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is (5-hydroxy-3-pyridinyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | (5-hydroxy-3-pyridinyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 63859389 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | (5-hydroxy-3-pyridinyl)-[4-(thiophen-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cncc(O)c1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H17N3O2S/c19-13-8-12(9-16-10-13)15(20)18-5-3-17(4-6-18)11-14-2-1-7-21-14/h1-2,7-10,19H,3-6,11H2 |
| InChIKey | ZKUMZLFANNHWID-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 56.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |