C23H21FN2O2S2 — CID 38388557
(4-fluorophenyl)-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]methanone (PubChem CID 38388557) has the molecular formula C23H21FN2O2S2 and a molecular weight of 440.57 g/mol. Its IUPAC name is (4-fluorophenyl)-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]methanone.
| Compound Name | (4-fluorophenyl)-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38388557 |
| Molecular Formula | C23H21FN2O2S2 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.10 |
| IUPAC Name | (4-fluorophenyl)-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)cc1)N1CCN(C(=O)c2ccccc2SCc2cccs2)CC1 |
| InChI | InChI=1S/C23H21FN2O2S2/c24-18-9-7-17(8-10-18)22(27)25-11-13-26(14-12-25)23(28)20-5-1-2-6-21(20)30-16-19-4-3-15-29-19/h1-10,15H,11-14,16H2 |
| InChIKey | ZIVJMHOURDUSAF-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |