C17H20N2OS2 — CID 119416113
1,4-diazepan-1-yl-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone (PubChem CID 119416113) has the molecular formula C17H20N2OS2 and a molecular weight of 332.49 g/mol. Its IUPAC name is 1,4-diazepan-1-yl-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone.
| Compound Name | 1,4-diazepan-1-yl-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 119416113 |
| Molecular Formula | C17H20N2OS2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1,4-diazepan-1-yl-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1SCc1cccs1)N1CCCNCC1 |
| InChI | InChI=1S/C17H20N2OS2/c20-17(19-10-4-8-18-9-11-19)15-6-1-2-7-16(15)22-13-14-5-3-12-21-14/h1-3,5-7,12,18H,4,8-11,13H2 |
| InChIKey | BHGMMGKHQXQLPQ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |