C20H21NO3S2 — CID 119175438
6-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxylic acid (PubChem CID 119175438) has the molecular formula C20H21NO3S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxylic acid.
| Compound Name | 6-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
|---|---|
| PubChem CID | 119175438 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 6-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]-6-azaspiro[2.5]octane-2-carboxylic acid |
| SMILES | O=C(O)C1CC12CCN(C(=O)c1ccccc1SCc1cccs1)CC2 |
| InChI | InChI=1S/C20H21NO3S2/c22-18(21-9-7-20(8-10-21)12-16(20)19(23)24)15-5-1-2-6-17(15)26-13-14-4-3-11-25-14/h1-6,11,16H,7-10,12-13H2,(H,23,24) |
| InChIKey | ZSKQKIOXGUEGII-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |