C20H20N4OS2 — CID 32646532
(4-pyrazin-2-ylpiperazin-1-yl)-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone (PubChem CID 32646532) has the molecular formula C20H20N4OS2 and a molecular weight of 396.54 g/mol. Its IUPAC name is (4-pyrazin-2-ylpiperazin-1-yl)-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone.
| Compound Name | (4-pyrazin-2-ylpiperazin-1-yl)-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone |
|---|---|
| PubChem CID | 32646532 |
| Molecular Formula | C20H20N4OS2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (4-pyrazin-2-ylpiperazin-1-yl)-[2-(thiophen-2-ylmethylsulfanyl)phenyl]methanone |
| SMILES | O=C(c1ccccc1SCc1cccs1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C20H20N4OS2/c25-20(24-11-9-23(10-12-24)19-14-21-7-8-22-19)17-5-1-2-6-18(17)27-15-16-4-3-13-26-16/h1-8,13-14H,9-12,15H2 |
| InChIKey | XVYRFDPUKIQBHF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |