C15H17N5OS — CID 42023433
(2-methylsulfanyl-3-pyridinyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 42023433) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is (2-methylsulfanyl-3-pyridinyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (2-methylsulfanyl-3-pyridinyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 42023433 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | (2-methylsulfanyl-3-pyridinyl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | CSc1ncccc1C(=O)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C15H17N5OS/c1-22-14-12(3-2-4-18-14)15(21)20-9-7-19(8-10-20)13-11-16-5-6-17-13/h2-6,11H,7-10H2,1H3 |
| InChIKey | KGFZFVNVGQMKMW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |