C20H21N5O — CID 18145987
(2,6-dimethylquinolin-4-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 18145987) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is (2,6-dimethylquinolin-4-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | (2,6-dimethylquinolin-4-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 18145987 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (2,6-dimethylquinolin-4-yl)-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1ccc2nc(C)cc(C(=O)N3CCN(c4cnccn4)CC3)c2c1 |
| InChI | InChI=1S/C20H21N5O/c1-14-3-4-18-16(11-14)17(12-15(2)23-18)20(26)25-9-7-24(8-10-25)19-13-21-5-6-22-19/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | FHTNOTDKENNMBA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |