C23H23N7O — CID 46995479
[8-methyl-2-(1-methylpyrazol-4-yl)quinolin-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone (PubChem CID 46995479) has the molecular formula C23H23N7O and a molecular weight of 413.49 g/mol. Its IUPAC name is [8-methyl-2-(1-methylpyrazol-4-yl)quinolin-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [8-methyl-2-(1-methylpyrazol-4-yl)quinolin-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 46995479 |
| Molecular Formula | C23H23N7O |
| Molecular Weight | 413.49 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | [8-methyl-2-(1-methylpyrazol-4-yl)quinolin-4-yl]-(4-pyrazin-2-ylpiperazin-1-yl)methanone |
| SMILES | Cc1cccc2c(C(=O)N3CCN(c4cnccn4)CC3)cc(-c3cnn(C)c3)nc12 |
| InChI | InChI=1S/C23H23N7O/c1-16-4-3-5-18-19(12-20(27-22(16)18)17-13-26-28(2)15-17)23(31)30-10-8-29(9-11-30)21-14-24-6-7-25-21/h3-7,12-15H,8-11H2,1-2H3 |
| InChIKey | AOMOFIATCDJVAT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.49 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |