C24H24N2O2S2 — CID 17466011
1-[4-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]phenyl]ethanone (PubChem CID 17466011) has the molecular formula C24H24N2O2S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 1-[4-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]phenyl]ethanone.
| Compound Name | 1-[4-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 17466011 |
| Molecular Formula | C24H24N2O2S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-[4-[4-[2-(thiophen-2-ylmethylsulfanyl)benzoyl]piperazin-1-yl]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(N2CCN(C(=O)c3ccccc3SCc3cccs3)CC2)cc1 |
| InChI | InChI=1S/C24H24N2O2S2/c1-18(27)19-8-10-20(11-9-19)25-12-14-26(15-13-25)24(28)22-6-2-3-7-23(22)30-17-21-5-4-16-29-21/h2-11,16H,12-15,17H2,1H3 |
| InChIKey | IPUVKLGGVYIZII-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |