C22H22N2OS2 — CID 18205229
N-(4-pyrrolidin-1-ylphenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 18205229) has the molecular formula C22H22N2OS2 and a molecular weight of 394.57 g/mol. Its IUPAC name is N-(4-pyrrolidin-1-ylphenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(4-pyrrolidin-1-ylphenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 18205229 |
| Molecular Formula | C22H22N2OS2 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | N-(4-pyrrolidin-1-ylphenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1ccc(N2CCCC2)cc1)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C22H22N2OS2/c25-22(23-17-9-11-18(12-10-17)24-13-3-4-14-24)20-7-1-2-8-21(20)27-16-19-6-5-15-26-19/h1-2,5-12,15H,3-4,13-14,16H2,(H,23,25) |
| InChIKey | VHLOYBWBLRRFBR-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|