C19H13ClN2OS2 — CID 9456173
N-(3-chloro-4-cyanophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 9456173) has the molecular formula C19H13ClN2OS2 and a molecular weight of 384.91 g/mol. Its IUPAC name is N-(3-chloro-4-cyanophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(3-chloro-4-cyanophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 9456173 |
| Molecular Formula | C19H13ClN2OS2 |
| Molecular Weight | 384.91 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | N-(3-chloro-4-cyanophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2ccccc2SCc2cccs2)cc1Cl |
| InChI | InChI=1S/C19H13ClN2OS2/c20-17-10-14(8-7-13(17)11-21)22-19(23)16-5-1-2-6-18(16)25-12-15-4-3-9-24-15/h1-10H,12H2,(H,22,23) |
| InChIKey | RHXRKVHHXVZZSI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.91 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |