C20H18N2O2S2 — CID 24513660
N-(3-acetamidophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 24513660) has the molecular formula C20H18N2O2S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is N-(3-acetamidophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(3-acetamidophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 24513660 |
| Molecular Formula | C20H18N2O2S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | N-(3-acetamidophenyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | CC(=O)Nc1cccc(NC(=O)c2ccccc2SCc2cccs2)c1 |
| InChI | InChI=1S/C20H18N2O2S2/c1-14(23)21-15-6-4-7-16(12-15)22-20(24)18-9-2-3-10-19(18)26-13-17-8-5-11-25-17/h2-12H,13H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | JKJCHSPIQLABHP-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |