C15H15NOS2 — CID 9399909
N-prop-2-enyl-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 9399909) has the molecular formula C15H15NOS2 and a molecular weight of 289.43 g/mol. Its IUPAC name is N-prop-2-enyl-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-prop-2-enyl-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 9399909 |
| Molecular Formula | C15H15NOS2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | N-prop-2-enyl-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | C=CCNC(=O)c1ccccc1SCc1cccs1 |
| InChI | InChI=1S/C15H15NOS2/c1-2-9-16-15(17)13-7-3-4-8-14(13)19-11-12-6-5-10-18-12/h2-8,10H,1,9,11H2,(H,16,17) |
| InChIKey | PAECMXDVAACSAT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|