C21H28N2OS2 — CID 55979886
N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide (PubChem CID 55979886) has the molecular formula C21H28N2OS2 and a molecular weight of 388.60 g/mol. Its IUPAC name is N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55979886 |
| Molecular Formula | C21H28N2OS2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophen-2-ylmethylsulfanyl)benzamide |
| SMILES | CC(CNC(=O)c1ccccc1SCc1cccs1)CN1CCCCC1 |
| InChI | InChI=1S/C21H28N2OS2/c1-17(15-23-11-5-2-6-12-23)14-22-21(24)19-9-3-4-10-20(19)26-16-18-8-7-13-25-18/h3-4,7-10,13,17H,2,5-6,11-12,14-16H2,1H3,(H,22,24) |
| InChIKey | WGJLAKOZOMGXQI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |