C19H25N3O2S2 — CID 75463775
N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide (PubChem CID 75463775) has the molecular formula C19H25N3O2S2 and a molecular weight of 391.56 g/mol. Its IUPAC name is N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide.
| Compound Name | N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 75463775 |
| Molecular Formula | C19H25N3O2S2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | N-(2-methyl-3-piperidin-1-ylpropyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
| SMILES | CC(CNC(=O)c1ccsc1NC(=O)c1cccs1)CN1CCCCC1 |
| InChI | InChI=1S/C19H25N3O2S2/c1-14(13-22-8-3-2-4-9-22)12-20-17(23)15-7-11-26-19(15)21-18(24)16-6-5-10-25-16/h5-7,10-11,14H,2-4,8-9,12-13H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | GDEPXJWXSVSYFZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |