C14H13N3O2S2 — CID 95979937
N-[(2R)-2-cyanopropyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide (PubChem CID 95979937) has the molecular formula C14H13N3O2S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is N-[(2R)-2-cyanopropyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide.
| Compound Name | N-[(2R)-2-cyanopropyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
|---|---|
| PubChem CID | 95979937 |
| Molecular Formula | C14H13N3O2S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | N-[(2R)-2-cyanopropyl]-2-(thiophene-2-carbonylamino)thiophene-3-carboxamide |
| SMILES | C[C@@H](C#N)CNC(=O)c1ccsc1NC(=O)c1cccs1 |
| InChI | InChI=1S/C14H13N3O2S2/c1-9(7-15)8-16-12(18)10-4-6-21-14(10)17-13(19)11-3-2-5-20-11/h2-6,9H,8H2,1H3,(H,16,18)(H,17,19)/t9-/m0/s1 |
| InChIKey | MUCXGPSUJBGFNQ-VIFPVBQESA-N |
| XLogP | 2.95 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |