C9H10N2OS — CID 130638279
N-[(1S)-1-cyanopropyl]thiophene-2-carboxamide (PubChem CID 130638279) has the molecular formula C9H10N2OS and a molecular weight of 194.26 g/mol. Its IUPAC name is N-[(1S)-1-cyanopropyl]thiophene-2-carboxamide.
| Compound Name | N-[(1S)-1-cyanopropyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 130638279 |
| Molecular Formula | C9H10N2OS |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.05 |
| IUPAC Name | N-[(1S)-1-cyanopropyl]thiophene-2-carboxamide |
| SMILES | CC[C@@H](C#N)NC(=O)c1cccs1 |
| InChI | InChI=1S/C9H10N2OS/c1-2-7(6-10)11-9(12)8-4-3-5-13-8/h3-5,7H,2H2,1H3,(H,11,12)/t7-/m0/s1 |
| InChIKey | RLGYIBRQUXJPGJ-ZETCQYMHSA-N |
| XLogP | 1.78 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |