C8H10N2O3S — CID 67329386
3-amino-3-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 67329386) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-amino-3-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | 3-amino-3-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 67329386 |
| Molecular Formula | C8H10N2O3S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.04 |
| IUPAC Name | 3-amino-3-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | NC(CC(=O)O)NC(=O)c1cccs1 |
| InChI | InChI=1S/C8H10N2O3S/c9-6(4-7(11)12)10-8(13)5-2-1-3-14-5/h1-3,6H,4,9H2,(H,10,13)(H,11,12) |
| InChIKey | SXQYLFSVEGYEHT-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|