C14H12ClNO3S — CID 45430554
3-(2-chlorophenyl)-3-(thiophene-2-carbonylamino)propanoic acid (PubChem CID 45430554) has the molecular formula C14H12ClNO3S and a molecular weight of 309.77 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-3-(thiophene-2-carbonylamino)propanoic acid.
| Compound Name | 3-(2-chlorophenyl)-3-(thiophene-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 45430554 |
| Molecular Formula | C14H12ClNO3S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 3-(2-chlorophenyl)-3-(thiophene-2-carbonylamino)propanoic acid |
| SMILES | O=C(O)CC(NC(=O)c1cccs1)c1ccccc1Cl |
| InChI | InChI=1S/C14H12ClNO3S/c15-10-5-2-1-4-9(10)11(8-13(17)18)16-14(19)12-6-3-7-20-12/h1-7,11H,8H2,(H,16,19)(H,17,18) |
| InChIKey | IESUASLYBXFTQY-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |