C16H16ClNO3S — CID 51256790
methyl 3-(2-chlorophenyl)-3-[(5-methylthiophene-2-carbonyl)amino]propanoate (PubChem CID 51256790) has the molecular formula C16H16ClNO3S and a molecular weight of 337.83 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[(5-methylthiophene-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[(5-methylthiophene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 51256790 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[(5-methylthiophene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(C)s1)c1ccccc1Cl |
| InChI | InChI=1S/C16H16ClNO3S/c1-10-7-8-14(22-10)16(20)18-13(9-15(19)21-2)11-5-3-4-6-12(11)17/h3-8,13H,9H2,1-2H3,(H,18,20) |
| InChIKey | JYZXJDDJHNGUFG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |