C18H17Cl2NO4S — CID 55430137
methyl 3-(2-chlorophenyl)-3-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]propanoate (PubChem CID 55430137) has the molecular formula C18H17Cl2NO4S and a molecular weight of 414.31 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]propanoate |
|---|---|
| PubChem CID | 55430137 |
| Molecular Formula | C18H17Cl2NO4S |
| Molecular Weight | 414.31 g/mol |
| Exact Mass | 413.03 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[[4-(5-chlorothiophen-2-yl)-4-oxobutanoyl]amino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CCC(=O)c1ccc(Cl)s1)c1ccccc1Cl |
| InChI | InChI=1S/C18H17Cl2NO4S/c1-25-18(24)10-13(11-4-2-3-5-12(11)19)21-17(23)9-6-14(22)15-7-8-16(20)26-15/h2-5,7-8,13H,6,9-10H2,1H3,(H,21,23) |
| InChIKey | XDFXBROZRQSUGH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.31 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |