C20H21ClFNO3 — CID 55925524
methyl 3-(2-chlorophenyl)-3-[3-(4-fluorophenyl)butanoylamino]propanoate (PubChem CID 55925524) has the molecular formula C20H21ClFNO3 and a molecular weight of 377.84 g/mol. Its IUPAC name is methyl 3-(2-chlorophenyl)-3-[3-(4-fluorophenyl)butanoylamino]propanoate.
| Compound Name | methyl 3-(2-chlorophenyl)-3-[3-(4-fluorophenyl)butanoylamino]propanoate |
|---|---|
| PubChem CID | 55925524 |
| Molecular Formula | C20H21ClFNO3 |
| Molecular Weight | 377.84 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | methyl 3-(2-chlorophenyl)-3-[3-(4-fluorophenyl)butanoylamino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CC(C)c1ccc(F)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C20H21ClFNO3/c1-13(14-7-9-15(22)10-8-14)11-19(24)23-18(12-20(25)26-2)16-5-3-4-6-17(16)21/h3-10,13,18H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | JLSFOXBVGNQNLV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.84 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |