C17H24ClNO3 — CID 51926264
propan-2-yl (3R)-3-(2-chlorophenyl)-3-(3-methylbutanoylamino)propanoate (PubChem CID 51926264) has the molecular formula C17H24ClNO3 and a molecular weight of 325.84 g/mol. Its IUPAC name is propan-2-yl (3R)-3-(2-chlorophenyl)-3-(3-methylbutanoylamino)propanoate.
| Compound Name | propan-2-yl (3R)-3-(2-chlorophenyl)-3-(3-methylbutanoylamino)propanoate |
|---|---|
| PubChem CID | 51926264 |
| Molecular Formula | C17H24ClNO3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | propan-2-yl (3R)-3-(2-chlorophenyl)-3-(3-methylbutanoylamino)propanoate |
| SMILES | CC(C)CC(=O)N[C@H](CC(=O)OC(C)C)c1ccccc1Cl |
| InChI | InChI=1S/C17H24ClNO3/c1-11(2)9-16(20)19-15(10-17(21)22-12(3)4)13-7-5-6-8-14(13)18/h5-8,11-12,15H,9-10H2,1-4H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | NOXYGKDMQMOWSU-OAHLLOKOSA-N |
| XLogP | 3.89 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |