C19H16ClF4NO3 — CID 43038135
propan-2-yl 3-(2-chlorophenyl)-3-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoate (PubChem CID 43038135) has the molecular formula C19H16ClF4NO3 and a molecular weight of 417.79 g/mol. Its IUPAC name is propan-2-yl 3-(2-chlorophenyl)-3-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoate.
| Compound Name | propan-2-yl 3-(2-chlorophenyl)-3-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 43038135 |
| Molecular Formula | C19H16ClF4NO3 |
| Molecular Weight | 417.79 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | propan-2-yl 3-(2-chlorophenyl)-3-[(2,3,4,5-tetrafluorobenzoyl)amino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1cc(F)c(F)c(F)c1F)c1ccccc1Cl |
| InChI | InChI=1S/C19H16ClF4NO3/c1-9(2)28-15(26)8-14(10-5-3-4-6-12(10)20)25-19(27)11-7-13(21)17(23)18(24)16(11)22/h3-7,9,14H,8H2,1-2H3,(H,25,27) |
| InChIKey | IMECDHDXIKRCCR-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.79 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|