C19H18Cl2N2O5 — CID 46637762
propan-2-yl 3-[(2,5-dichlorobenzoyl)amino]-3-(2-nitrophenyl)propanoate (PubChem CID 46637762) has the molecular formula C19H18Cl2N2O5 and a molecular weight of 425.27 g/mol. Its IUPAC name is propan-2-yl 3-[(2,5-dichlorobenzoyl)amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(2,5-dichlorobenzoyl)amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46637762 |
| Molecular Formula | C19H18Cl2N2O5 |
| Molecular Weight | 425.27 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | propan-2-yl 3-[(2,5-dichlorobenzoyl)amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1cc(Cl)ccc1Cl)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18Cl2N2O5/c1-11(2)28-18(24)10-16(13-5-3-4-6-17(13)23(26)27)22-19(25)14-9-12(20)7-8-15(14)21/h3-9,11,16H,10H2,1-2H3,(H,22,25) |
| InChIKey | GLPBKWCNTMNWHY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.27 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|