C21H24ClN3O7S — CID 46637742
propan-2-yl 3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 46637742) has the molecular formula C21H24ClN3O7S and a molecular weight of 497.96 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 46637742 |
| Molecular Formula | C21H24ClN3O7S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | propan-2-yl 3-[[2-(3-chloro-N-methylsulfonylanilino)acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)CN(c1cccc(Cl)c1)S(C)(=O)=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24ClN3O7S/c1-14(2)32-21(27)12-18(17-9-4-5-10-19(17)25(28)29)23-20(26)13-24(33(3,30)31)16-8-6-7-15(22)11-16/h4-11,14,18H,12-13H2,1-3H3,(H,23,26) |
| InChIKey | FYALBBUJGMSJGH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|