C18H24N2O7S — CID 56567837
propan-2-yl 3-[3-(2-methoxy-2-oxoethyl)sulfanylpropanoylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 56567837) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is propan-2-yl 3-[3-(2-methoxy-2-oxoethyl)sulfanylpropanoylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[3-(2-methoxy-2-oxoethyl)sulfanylpropanoylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 56567837 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | propan-2-yl 3-[3-(2-methoxy-2-oxoethyl)sulfanylpropanoylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | COC(=O)CSCCC(=O)NC(CC(=O)OC(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H24N2O7S/c1-12(2)27-17(22)10-14(13-6-4-5-7-15(13)20(24)25)19-16(21)8-9-28-11-18(23)26-3/h4-7,12,14H,8-11H2,1-3H3,(H,19,21) |
| InChIKey | IXYLEZLQKRKWEZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 124.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|