C23H27N3O8 — CID 55440052
propan-2-yl 3-[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55440052) has the molecular formula C23H27N3O8 and a molecular weight of 473.48 g/mol. Its IUPAC name is propan-2-yl 3-[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55440052 |
| Molecular Formula | C23H27N3O8 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | propan-2-yl 3-[[2-[(3,4-dimethoxybenzoyl)amino]acetyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | COc1ccc(C(=O)NCC(=O)NC(CC(=O)OC(C)C)c2ccccc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C23H27N3O8/c1-14(2)34-22(28)12-17(16-7-5-6-8-18(16)26(30)31)25-21(27)13-24-23(29)15-9-10-19(32-3)20(11-15)33-4/h5-11,14,17H,12-13H2,1-4H3,(H,24,29)(H,25,27) |
| InChIKey | KIRVTWGNBTXZKS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|