C23H29N3O6 — CID 40810469
propan-2-yl (3R)-3-[[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 40810469) has the molecular formula C23H29N3O6 and a molecular weight of 443.50 g/mol. Its IUPAC name is propan-2-yl (3R)-3-[[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl (3R)-3-[[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 40810469 |
| Molecular Formula | C23H29N3O6 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | propan-2-yl (3R)-3-[[(1S)-1-(2-methoxy-5-methylphenyl)ethyl]carbamoylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | COc1ccc(C)cc1[C@H](C)NC(=O)N[C@H](CC(=O)OC(C)C)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H29N3O6/c1-14(2)32-22(27)13-19(17-8-6-7-9-20(17)26(29)30)25-23(28)24-16(4)18-12-15(3)10-11-21(18)31-5/h6-12,14,16,19H,13H2,1-5H3,(H2,24,25,28)/t16-,19+/m0/s1 |
| InChIKey | DBVJQDHLKHDFNP-QFBILLFUSA-N |
| XLogP | 4.36 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|