C19H21BrN2O6S — CID 55564872
propan-2-yl 3-[(2-bromo-4-methylphenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 55564872) has the molecular formula C19H21BrN2O6S and a molecular weight of 485.36 g/mol. Its IUPAC name is propan-2-yl 3-[(2-bromo-4-methylphenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(2-bromo-4-methylphenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55564872 |
| Molecular Formula | C19H21BrN2O6S |
| Molecular Weight | 485.36 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | propan-2-yl 3-[(2-bromo-4-methylphenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(CC(=O)OC(C)C)c2ccccc2[N+](=O)[O-])c(Br)c1 |
| InChI | InChI=1S/C19H21BrN2O6S/c1-12(2)28-19(23)11-16(14-6-4-5-7-17(14)22(24)25)21-29(26,27)18-9-8-13(3)10-15(18)20/h4-10,12,16,21H,11H2,1-3H3 |
| InChIKey | LGNADSLOSRTLBJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|