C18H19BrN2O6S — CID 55434691
propan-2-yl 3-[(3-bromophenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate (PubChem CID 55434691) has the molecular formula C18H19BrN2O6S and a molecular weight of 471.33 g/mol. Its IUPAC name is propan-2-yl 3-[(3-bromophenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[(3-bromophenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55434691 |
| Molecular Formula | C18H19BrN2O6S |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | propan-2-yl 3-[(3-bromophenyl)sulfonylamino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NS(=O)(=O)c1cccc(Br)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19BrN2O6S/c1-12(2)27-18(22)11-16(15-8-3-4-9-17(15)21(23)24)20-28(25,26)14-7-5-6-13(19)10-14/h3-10,12,16,20H,11H2,1-2H3 |
| InChIKey | RBJYHVNXPIUETD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|