C19H24N4O7S — CID 55471990
propan-2-yl 3-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55471990) has the molecular formula C19H24N4O7S and a molecular weight of 452.49 g/mol. Its IUPAC name is propan-2-yl 3-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55471990 |
| Molecular Formula | C19H24N4O7S |
| Molecular Weight | 452.49 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | propan-2-yl 3-[[1-methyl-4-(methylsulfamoyl)pyrrole-2-carbonyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NC(CC(=O)OC(C)C)c2ccccc2[N+](=O)[O-])n(C)c1 |
| InChI | InChI=1S/C19H24N4O7S/c1-12(2)30-18(24)10-15(14-7-5-6-8-16(14)23(26)27)21-19(25)17-9-13(11-22(17)4)31(28,29)20-3/h5-9,11-12,15,20H,10H2,1-4H3,(H,21,25) |
| InChIKey | RPBRHUYQPVSFLI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.49 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|