C20H22N4O6 — CID 43041638
propan-2-yl 3-[[4-(carbamoylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 43041638) has the molecular formula C20H22N4O6 and a molecular weight of 414.42 g/mol. Its IUPAC name is propan-2-yl 3-[[4-(carbamoylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[4-(carbamoylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 43041638 |
| Molecular Formula | C20H22N4O6 |
| Molecular Weight | 414.42 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | propan-2-yl 3-[[4-(carbamoylamino)benzoyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1ccc(NC(N)=O)cc1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H22N4O6/c1-12(2)30-18(25)11-16(15-5-3-4-6-17(15)24(28)29)23-19(26)13-7-9-14(10-8-13)22-20(21)27/h3-10,12,16H,11H2,1-2H3,(H,23,26)(H3,21,22,27) |
| InChIKey | JEGZSCKYNQZCCS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 153.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.42 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|