C24H27N3O6 — CID 55649560
propan-2-yl 3-[[3-[(2-methylcyclopropanecarbonyl)amino]benzoyl]amino]-3-(2-nitrophenyl)propanoate (PubChem CID 55649560) has the molecular formula C24H27N3O6 and a molecular weight of 453.50 g/mol. Its IUPAC name is propan-2-yl 3-[[3-[(2-methylcyclopropanecarbonyl)amino]benzoyl]amino]-3-(2-nitrophenyl)propanoate.
| Compound Name | propan-2-yl 3-[[3-[(2-methylcyclopropanecarbonyl)amino]benzoyl]amino]-3-(2-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 55649560 |
| Molecular Formula | C24H27N3O6 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | propan-2-yl 3-[[3-[(2-methylcyclopropanecarbonyl)amino]benzoyl]amino]-3-(2-nitrophenyl)propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)c1cccc(NC(=O)C2CC2C)c1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H27N3O6/c1-14(2)33-22(28)13-20(18-9-4-5-10-21(18)27(31)32)26-23(29)16-7-6-8-17(12-16)25-24(30)19-11-15(19)3/h4-10,12,14-15,19-20H,11,13H2,1-3H3,(H,25,30)(H,26,29) |
| InChIKey | XPJRAFMTXQPXRP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 127.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|