C19H28ClN3O5 — CID 119695105
propan-2-yl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride (PubChem CID 119695105) has the molecular formula C19H28ClN3O5 and a molecular weight of 413.90 g/mol. Its IUPAC name is propan-2-yl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride.
| Compound Name | propan-2-yl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 119695105 |
| Molecular Formula | C19H28ClN3O5 |
| Molecular Weight | 413.90 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | propan-2-yl 3-[(3-aminocyclohexanecarbonyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride |
| SMILES | CC(C)OC(=O)CC(NC(=O)C1CCCC(N)C1)c1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C19H27N3O5.ClH/c1-12(2)27-18(23)11-16(15-8-3-4-9-17(15)22(25)26)21-19(24)13-6-5-7-14(20)10-13;/h3-4,8-9,12-14,16H,5-7,10-11,20H2,1-2H3,(H,21,24);1H |
| InChIKey | BNFPHQIYHQZTHX-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.90 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|