C23H23F3N2O5 — CID 134009747
propan-2-yl 3-(2-nitrophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]propanoate (PubChem CID 134009747) has the molecular formula C23H23F3N2O5 and a molecular weight of 464.44 g/mol. Its IUPAC name is propan-2-yl 3-(2-nitrophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]propanoate.
| Compound Name | propan-2-yl 3-(2-nitrophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]propanoate |
|---|---|
| PubChem CID | 134009747 |
| Molecular Formula | C23H23F3N2O5 |
| Molecular Weight | 464.44 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | propan-2-yl 3-(2-nitrophenyl)-3-[[2-[2-(trifluoromethyl)phenyl]cyclopropanecarbonyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C1CC1c1ccccc1C(F)(F)F)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H23F3N2O5/c1-13(2)33-21(29)12-19(15-8-4-6-10-20(15)28(31)32)27-22(30)17-11-16(17)14-7-3-5-9-18(14)23(24,25)26/h3-10,13,16-17,19H,11-12H2,1-2H3,(H,27,30) |
| InChIKey | RGZRFQWYEWAMIZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|