C22H24FNO3 — CID 134009754
propan-2-yl 3-[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]-3-phenylpropanoate (PubChem CID 134009754) has the molecular formula C22H24FNO3 and a molecular weight of 369.44 g/mol. Its IUPAC name is propan-2-yl 3-[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 134009754 |
| Molecular Formula | C22H24FNO3 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | propan-2-yl 3-[[2-(2-fluorophenyl)cyclopropanecarbonyl]amino]-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C1CC1c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C22H24FNO3/c1-14(2)27-21(25)13-20(15-8-4-3-5-9-15)24-22(26)18-12-17(18)16-10-6-7-11-19(16)23/h3-11,14,17-18,20H,12-13H2,1-2H3,(H,24,26) |
| InChIKey | RWNSOYUJGGPVPB-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |