C17H23NO4 — CID 43048320
propan-2-yl 3-(oxolane-2-carbonylamino)-3-phenylpropanoate (PubChem CID 43048320) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is propan-2-yl 3-(oxolane-2-carbonylamino)-3-phenylpropanoate.
| Compound Name | propan-2-yl 3-(oxolane-2-carbonylamino)-3-phenylpropanoate |
|---|---|
| PubChem CID | 43048320 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | propan-2-yl 3-(oxolane-2-carbonylamino)-3-phenylpropanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-12(2)22-16(19)11-14(13-7-4-3-5-8-13)18-17(20)15-9-6-10-21-15/h3-5,7-8,12,14-15H,6,9-11H2,1-2H3,(H,18,20) |
| InChIKey | WBRXHGPRLNTDOC-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |