C23H33N3O4 — CID 47043068
propan-2-yl 3-phenyl-3-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]propanoate (PubChem CID 47043068) has the molecular formula C23H33N3O4 and a molecular weight of 415.53 g/mol. Its IUPAC name is propan-2-yl 3-phenyl-3-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]propanoate.
| Compound Name | propan-2-yl 3-phenyl-3-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 47043068 |
| Molecular Formula | C23H33N3O4 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.25 |
| IUPAC Name | propan-2-yl 3-phenyl-3-[[1-(pyrrolidine-1-carbonyl)piperidine-3-carbonyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C1CCCN(C(=O)N2CCCC2)C1)c1ccccc1 |
| InChI | InChI=1S/C23H33N3O4/c1-17(2)30-21(27)15-20(18-9-4-3-5-10-18)24-22(28)19-11-8-14-26(16-19)23(29)25-12-6-7-13-25/h3-5,9-10,17,19-20H,6-8,11-16H2,1-2H3,(H,24,28) |
| InChIKey | UHKVOSVDFONYRF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |