C16H24ClN3O6 — CID 120984159
propan-2-yl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride (PubChem CID 120984159) has the molecular formula C16H24ClN3O6 and a molecular weight of 389.84 g/mol. Its IUPAC name is propan-2-yl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride.
| Compound Name | propan-2-yl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride |
|---|---|
| PubChem CID | 120984159 |
| Molecular Formula | C16H24ClN3O6 |
| Molecular Weight | 389.84 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | propan-2-yl 3-[(2-amino-3-methoxypropanoyl)amino]-3-(2-nitrophenyl)propanoate;hydrochloride |
| SMILES | COCC(N)C(=O)NC(CC(=O)OC(C)C)c1ccccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C16H23N3O6.ClH/c1-10(2)25-15(20)8-13(18-16(21)12(17)9-24-3)11-6-4-5-7-14(11)19(22)23;/h4-7,10,12-13H,8-9,17H2,1-3H3,(H,18,21);1H |
| InChIKey | MRWQXDWNWLVHKS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 133.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.84 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|