C25H30N4O6 — CID 55440151
propan-2-yl 3-(2-nitrophenyl)-3-[[1-(phenylcarbamoyl)piperidine-4-carbonyl]amino]propanoate (PubChem CID 55440151) has the molecular formula C25H30N4O6 and a molecular weight of 482.54 g/mol. Its IUPAC name is propan-2-yl 3-(2-nitrophenyl)-3-[[1-(phenylcarbamoyl)piperidine-4-carbonyl]amino]propanoate.
| Compound Name | propan-2-yl 3-(2-nitrophenyl)-3-[[1-(phenylcarbamoyl)piperidine-4-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 55440151 |
| Molecular Formula | C25H30N4O6 |
| Molecular Weight | 482.54 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | propan-2-yl 3-(2-nitrophenyl)-3-[[1-(phenylcarbamoyl)piperidine-4-carbonyl]amino]propanoate |
| SMILES | CC(C)OC(=O)CC(NC(=O)C1CCN(C(=O)Nc2ccccc2)CC1)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C25H30N4O6/c1-17(2)35-23(30)16-21(20-10-6-7-11-22(20)29(33)34)27-24(31)18-12-14-28(15-13-18)25(32)26-19-8-4-3-5-9-19/h3-11,17-18,21H,12-16H2,1-2H3,(H,26,32)(H,27,31) |
| InChIKey | CLJSZWMZULKMAS-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|