C25H27N3O2 — CID 42907490
4-N-(1-naphthalen-1-ylethyl)-1-N-phenylpiperidine-1,4-dicarboxamide (PubChem CID 42907490) has the molecular formula C25H27N3O2 and a molecular weight of 401.51 g/mol. Its IUPAC name is 4-N-(1-naphthalen-1-ylethyl)-1-N-phenylpiperidine-1,4-dicarboxamide.
| Compound Name | 4-N-(1-naphthalen-1-ylethyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 42907490 |
| Molecular Formula | C25H27N3O2 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 4-N-(1-naphthalen-1-ylethyl)-1-N-phenylpiperidine-1,4-dicarboxamide |
| SMILES | CC(NC(=O)C1CCN(C(=O)Nc2ccccc2)CC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C25H27N3O2/c1-18(22-13-7-9-19-8-5-6-12-23(19)22)26-24(29)20-14-16-28(17-15-20)25(30)27-21-10-3-2-4-11-21/h2-13,18,20H,14-17H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | SGDWFSRGZPTAKM-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |