C26H30N2O — CID 90670154
1-[(1R)-1-naphthalen-1-ylethyl]-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide (PubChem CID 90670154) has the molecular formula C26H30N2O and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-[(1R)-1-naphthalen-1-ylethyl]-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide.
| Compound Name | 1-[(1R)-1-naphthalen-1-ylethyl]-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 90670154 |
| Molecular Formula | C26H30N2O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | 1-[(1R)-1-naphthalen-1-ylethyl]-N-[(1R)-1-phenylethyl]piperidine-4-carboxamide |
| SMILES | C[C@H](c1cccc2ccccc12)N1CCC(C(=O)N[C@H](C)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H30N2O/c1-19(21-9-4-3-5-10-21)27-26(29)23-15-17-28(18-16-23)20(2)24-14-8-12-22-11-6-7-13-25(22)24/h3-14,19-20,23H,15-18H2,1-2H3,(H,27,29)/t19-,20-/m1/s1 |
| InChIKey | BPBANXMOPPUBKE-WOJBJXKFSA-N |
| XLogP | 5.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |